C30H39F2N7O3 — CID 139463465
4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]butanoic acid (PubChem CID 139463465) has the molecular formula C30H39F2N7O3 and a molecular weight of 583.68 g/mol. Its IUPAC name is 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]butanoic acid.
| Compound Name | 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463465 |
| Molecular Formula | C30H39F2N7O3 |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.31 |
| IUPAC Name | 4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[6-(dimethylamino)pyrimidin-4-yl]amino]butanoic acid |
| SMILES | CN(C)c1cc(NC(CCN(CCCCc2ccc3c(n2)NCCC3)CCOc2cc(F)cc(F)c2)C(=O)O)ncn1 |
| InChI | InChI=1S/C30H39F2N7O3/c1-38(2)28-19-27(34-20-35-28)37-26(30(40)41)10-13-39(14-15-42-25-17-22(31)16-23(32)18-25)12-4-3-7-24-9-8-21-6-5-11-33-29(21)36-24/h8-9,16-20,26H,3-7,10-15H2,1-2H3,(H,33,36)(H,40,41)(H,34,35,37) |
| InChIKey | SSEQRNUFEAHLAT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|