C30H38F2N6O3 — CID 139463498
(2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoic acid (PubChem CID 139463498) has the molecular formula C30H38F2N6O3 and a molecular weight of 568.67 g/mol. Its IUPAC name is (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463498 |
| Molecular Formula | C30H38F2N6O3 |
| Molecular Weight | 568.67 g/mol |
| Exact Mass | 568.30 |
| IUPAC Name | (2S)-4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-pyridin-4-yl-2-pyridinyl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)Nc1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C30H38F2N6O3/c31-27(32)21-41-19-18-38(16-2-1-5-25-7-6-23-4-3-12-35-29(23)36-25)17-11-26(30(39)40)37-28-20-24(10-15-34-28)22-8-13-33-14-9-22/h6-10,13-15,20,26-27H,1-5,11-12,16-19,21H2,(H,34,37)(H,35,36)(H,39,40)/t26-/m0/s1 |
| InChIKey | KYOSBPNMRFXACG-SANMLTNESA-N |
| XLogP | 4.76 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.67 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|