C24H34ClFN6O3 — CID 139463547
2-[(6-chloropyrimidin-4-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463547) has the molecular formula C24H34ClFN6O3 and a molecular weight of 509.03 g/mol. Its IUPAC name is 2-[(6-chloropyrimidin-4-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-[(6-chloropyrimidin-4-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463547 |
| Molecular Formula | C24H34ClFN6O3 |
| Molecular Weight | 509.03 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 2-[(6-chloropyrimidin-4-yl)amino]-4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | COCC(F)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1cc(Cl)ncn1)C(=O)O |
| InChI | InChI=1S/C24H34ClFN6O3/c1-35-15-18(26)14-32(12-9-20(24(33)34)31-22-13-21(25)28-16-29-22)11-3-2-6-19-8-7-17-5-4-10-27-23(17)30-19/h7-8,13,16,18,20H,2-6,9-12,14-15H2,1H3,(H,27,30)(H,33,34)(H,28,29,31) |
| InChIKey | DBNGCKIFVVOWQP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.03 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|