C31H40FN5O3 — CID 139463567
4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid (PubChem CID 139463567) has the molecular formula C31H40FN5O3 and a molecular weight of 549.69 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid.
| Compound Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463567 |
| Molecular Formula | C31H40FN5O3 |
| Molecular Weight | 549.69 g/mol |
| Exact Mass | 549.31 |
| IUPAC Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenyl-2-pyridinyl)amino]butanoic acid |
| SMILES | COCC(F)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ccc(-c2ccccc2)cn1)C(=O)O |
| InChI | InChI=1S/C31H40FN5O3/c1-40-22-26(32)21-37(18-6-5-11-27-14-12-24-10-7-17-33-30(24)35-27)19-16-28(31(38)39)36-29-15-13-25(20-34-29)23-8-3-2-4-9-23/h2-4,8-9,12-15,20,26,28H,5-7,10-11,16-19,21-22H2,1H3,(H,33,35)(H,34,36)(H,38,39) |
| InChIKey | HCMYYRIKIGKIQG-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|