C25H36FN5O3 — CID 139463578
4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid (PubChem CID 139463578) has the molecular formula C25H36FN5O3 and a molecular weight of 473.59 g/mol. Its IUPAC name is 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid.
| Compound Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463578 |
| Molecular Formula | C25H36FN5O3 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | 4-[(2-fluoro-3-methoxypropyl)-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyridin-2-ylamino)butanoic acid |
| SMILES | COCC(F)CN(CCCCc1ccc2c(n1)NCCC2)CCC(Nc1ccccn1)C(=O)O |
| InChI | InChI=1S/C25H36FN5O3/c1-34-18-20(26)17-31(16-12-22(25(32)33)30-23-9-2-4-13-27-23)15-5-3-8-21-11-10-19-7-6-14-28-24(19)29-21/h2,4,9-11,13,20,22H,3,5-8,12,14-18H2,1H3,(H,27,30)(H,28,29)(H,32,33) |
| InChIKey | AFKGMCAYJIYMLW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|