C31H35F2N5O3S — CID 139463596
2-(1,3-benzothiazol-2-ylamino)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463596) has the molecular formula C31H35F2N5O3S and a molecular weight of 595.72 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylamino)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylamino)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463596 |
| Molecular Formula | C31H35F2N5O3S |
| Molecular Weight | 595.72 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylamino)-4-[2-(3,5-difluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1cc(F)cc(F)c1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C31H35F2N5O3S/c32-22-18-23(33)20-25(19-22)41-17-16-38(14-4-3-7-24-11-10-21-6-5-13-34-29(21)35-24)15-12-27(30(39)40)37-31-36-26-8-1-2-9-28(26)42-31/h1-2,8-11,18-20,27H,3-7,12-17H2,(H,34,35)(H,36,37)(H,39,40) |
| InChIKey | RTMSHXQPAVRETH-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.72 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|