C31H39F2N5O3 — CID 139463601
4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid (PubChem CID 139463601) has the molecular formula C31H39F2N5O3 and a molecular weight of 567.68 g/mol. Its IUPAC name is 4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid.
| Compound Name | 4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463601 |
| Molecular Formula | C31H39F2N5O3 |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | 4-[2-(2,2-difluoroethoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(4-phenyl-2-pyridinyl)amino]butanoic acid |
| SMILES | O=C(O)C(CCN(CCCCc1ccc2c(n1)NCCC2)CCOCC(F)F)Nc1cc(-c2ccccc2)ccn1 |
| InChI | InChI=1S/C31H39F2N5O3/c32-28(33)22-41-20-19-38(17-5-4-10-26-12-11-24-9-6-15-35-30(24)36-26)18-14-27(31(39)40)37-29-21-25(13-16-34-29)23-7-2-1-3-8-23/h1-3,7-8,11-13,16,21,27-28H,4-6,9-10,14-15,17-20,22H2,(H,34,37)(H,35,36)(H,39,40) |
| InChIKey | JAGIISNCZVBQPV-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|