C29H35FN8O3 — CID 139463649
(2S)-4-[2-(4-fluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139463649) has the molecular formula C29H35FN8O3 and a molecular weight of 562.65 g/mol. Its IUPAC name is (2S)-4-[2-(4-fluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2-(4-fluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463649 |
| Molecular Formula | C29H35FN8O3 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.28 |
| IUPAC Name | (2S)-4-[2-(4-fluorophenoxy)ethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(1H-pyrazolo[5,4-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1ccc(F)cc1)Nc1ncnc2[nH]ncc12 |
| InChI | InChI=1S/C29H35FN8O3/c30-21-7-10-23(11-8-21)41-17-16-38(14-2-1-5-22-9-6-20-4-3-13-31-26(20)35-22)15-12-25(29(39)40)36-27-24-18-34-37-28(24)33-19-32-27/h6-11,18-19,25H,1-5,12-17H2,(H,31,35)(H,39,40)(H2,32,33,34,36,37)/t25-/m0/s1 |
| InChIKey | NYIJVOPSVVFNKF-VWLOTQADSA-N |
| XLogP | 3.90 |
| TPSA | 141.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|