C24H35FN6O3 — CID 139463718
(2S)-2-[(5-fluoropyrimidin-2-yl)amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139463718) has the molecular formula C24H35FN6O3 and a molecular weight of 474.58 g/mol. Its IUPAC name is (2S)-2-[(5-fluoropyrimidin-2-yl)amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(5-fluoropyrimidin-2-yl)amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139463718 |
| Molecular Formula | C24H35FN6O3 |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | (2S)-2-[(5-fluoropyrimidin-2-yl)amino]-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | CO[C@H](C)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncc(F)cn1)C(=O)O |
| InChI | InChI=1S/C24H35FN6O3/c1-17(34-2)16-31(13-10-21(23(32)33)30-24-27-14-19(25)15-28-24)12-4-3-7-20-9-8-18-6-5-11-26-22(18)29-20/h8-9,14-15,17,21H,3-7,10-13,16H2,1-2H3,(H,26,29)(H,32,33)(H,27,28,30)/t17-,21+/m1/s1 |
| InChIKey | HFRJIGSMLPAEPX-UTKZUKDTSA-N |
| XLogP | 2.98 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|