C29H39FN6O3 — CID 139463917
(2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-methylquinazolin-4-yl)amino]butanoic acid (PubChem CID 139463917) has the molecular formula C29H39FN6O3 and a molecular weight of 538.67 g/mol. Its IUPAC name is (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-methylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-methylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139463917 |
| Molecular Formula | C29H39FN6O3 |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.31 |
| IUPAC Name | (2S)-4-[[(2S)-2-fluoro-3-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-methylquinazolin-4-yl)amino]butanoic acid |
| SMILES | COC[C@@H](F)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1nc(C)nc2ccccc12)C(=O)O |
| InChI | InChI=1S/C29H39FN6O3/c1-20-32-25-11-4-3-10-24(25)28(33-20)35-26(29(37)38)14-17-36(18-22(30)19-39-2)16-6-5-9-23-13-12-21-8-7-15-31-27(21)34-23/h3-4,10-13,22,26H,5-9,14-19H2,1-2H3,(H,31,34)(H,37,38)(H,32,33,35)/t22-,26-/m0/s1 |
| InChIKey | IUWCJBLRXIAUAG-NVQXNPDNSA-N |
| XLogP | 4.26 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|