C26H32F2N6O2 — CID 139463971
(2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (PubChem CID 139463971) has the molecular formula C26H32F2N6O2 and a molecular weight of 498.58 g/mol. Its IUPAC name is (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139463971 |
| Molecular Formula | C26H32F2N6O2 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C26H32F2N6O2/c27-23(28)16-34(14-4-3-7-19-11-10-18-6-5-13-29-24(18)32-19)15-12-22(26(35)36)33-25-20-8-1-2-9-21(20)30-17-31-25/h1-2,8-11,17,22-23H,3-7,12-16H2,(H,29,32)(H,35,36)(H,30,31,33)/t22-/m0/s1 |
| InChIKey | QLQWVDXKTCOBFF-QFIPXVFZSA-N |
| XLogP | 4.23 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|