C32H38FN7O2 — CID 139464040
4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid (PubChem CID 139464040) has the molecular formula C32H38FN7O2 and a molecular weight of 571.70 g/mol. Its IUPAC name is 4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | 4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464040 |
| Molecular Formula | C32H38FN7O2 |
| Molecular Weight | 571.70 g/mol |
| Exact Mass | 571.31 |
| IUPAC Name | 4-[3-fluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)C(CCN(CCCF)CCCCc1ccc2c(n1)NCCC2)Nc1nc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C32H38FN7O2/c33-16-7-20-40(19-4-3-10-25-14-13-23-8-6-18-35-29(23)36-25)21-15-28(32(41)42)38-31-26-11-1-2-12-27(26)37-30(39-31)24-9-5-17-34-22-24/h1-2,5,9,11-14,17,22,28H,3-4,6-8,10,15-16,18-21H2,(H,35,36)(H,41,42)(H,37,38,39) |
| InChIKey | XBPSBMYBGPITPQ-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.70 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|