C31H35F2N7O2 — CID 139464144
(2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid (PubChem CID 139464144) has the molecular formula C31H35F2N7O2 and a molecular weight of 575.66 g/mol. Its IUPAC name is (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464144 |
| Molecular Formula | C31H35F2N7O2 |
| Molecular Weight | 575.66 g/mol |
| Exact Mass | 575.28 |
| IUPAC Name | (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)Nc1nc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C31H35F2N7O2/c32-27(33)20-40(17-4-3-9-23-13-12-21-7-6-16-35-28(21)36-23)18-14-26(31(41)42)38-30-24-10-1-2-11-25(24)37-29(39-30)22-8-5-15-34-19-22/h1-2,5,8,10-13,15,19,26-27H,3-4,6-7,9,14,16-18,20H2,(H,35,36)(H,41,42)(H,37,38,39)/t26-/m0/s1 |
| InChIKey | PCZKSCFYEHCLNY-SANMLTNESA-N |
| XLogP | 5.29 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|