C34H40N6O3 — CID 139464186
(2S)-4-[2-phenoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrimidin-4-yl)amino]butanoic acid (PubChem CID 139464186) has the molecular formula C34H40N6O3 and a molecular weight of 580.73 g/mol. Its IUPAC name is (2S)-4-[2-phenoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrimidin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2-phenoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464186 |
| Molecular Formula | C34H40N6O3 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | (2S)-4-[2-phenoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(6-phenylpyrimidin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCOc1ccccc1)Nc1cc(-c2ccccc2)ncn1 |
| InChI | InChI=1S/C34H40N6O3/c41-34(42)30(39-32-24-31(36-25-37-32)26-10-3-1-4-11-26)18-21-40(22-23-43-29-14-5-2-6-15-29)20-8-7-13-28-17-16-27-12-9-19-35-33(27)38-28/h1-6,10-11,14-17,24-25,30H,7-9,12-13,18-23H2,(H,35,38)(H,41,42)(H,36,37,39)/t30-/m0/s1 |
| InChIKey | XGFDNCINTPJMBL-PMERELPUSA-N |
| XLogP | 5.56 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|