C25H34F2N6O2 — CID 139464393
(2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid (PubChem CID 139464393) has the molecular formula C25H34F2N6O2 and a molecular weight of 488.58 g/mol. Its IUPAC name is (2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid.
| Compound Name | (2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
|---|---|
| PubChem CID | 139464393 |
| Molecular Formula | C25H34F2N6O2 |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | (2S)-2-[(5-cyclopropylpyrimidin-2-yl)amino]-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)Nc1ncc(C2CC2)cn1 |
| InChI | InChI=1S/C25H34F2N6O2/c26-22(27)16-33(12-2-1-5-20-9-8-18-4-3-11-28-23(18)31-20)13-10-21(24(34)35)32-25-29-14-19(15-30-25)17-6-7-17/h8-9,14-15,17,21-22H,1-7,10-13,16H2,(H,28,31)(H,34,35)(H,29,30,32)/t21-/m0/s1 |
| InChIKey | HRDIRQDRRJCNJC-NRFANRHFSA-N |
| XLogP | 3.95 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|