C28H34F2N6O2 — CID 139464414
(2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid (PubChem CID 139464414) has the molecular formula C28H34F2N6O2 and a molecular weight of 524.62 g/mol. Its IUPAC name is (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464414 |
| Molecular Formula | C28H34F2N6O2 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | (2S)-4-[2,2-difluoroethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(5-phenylpyrimidin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CC(F)F)Nc1ncncc1-c1ccccc1 |
| InChI | InChI=1S/C28H34F2N6O2/c29-25(30)18-36(15-5-4-10-22-12-11-21-9-6-14-32-26(21)34-22)16-13-24(28(37)38)35-27-23(17-31-19-33-27)20-7-2-1-3-8-20/h1-3,7-8,11-12,17,19,24-25H,4-6,9-10,13-16,18H2,(H,32,34)(H,37,38)(H,31,33,35)/t24-/m0/s1 |
| InChIKey | DYARWZMBGRSJFR-DEOSSOPVSA-N |
| XLogP | 4.74 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|