C25H34F3N7O3 — CID 139464425
(2S)-4-[[2-(dimethylamino)-2-oxoethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid (PubChem CID 139464425) has the molecular formula C25H34F3N7O3 and a molecular weight of 537.59 g/mol. Its IUPAC name is (2S)-4-[[2-(dimethylamino)-2-oxoethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid.
| Compound Name | (2S)-4-[[2-(dimethylamino)-2-oxoethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 139464425 |
| Molecular Formula | C25H34F3N7O3 |
| Molecular Weight | 537.59 g/mol |
| Exact Mass | 537.27 |
| IUPAC Name | (2S)-4-[[2-(dimethylamino)-2-oxoethyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[[5-(trifluoromethyl)pyrimidin-2-yl]amino]butanoic acid |
| SMILES | CN(C)C(=O)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncc(C(F)(F)F)cn1)C(=O)O |
| InChI | InChI=1S/C25H34F3N7O3/c1-34(2)21(36)16-35(12-4-3-7-19-9-8-17-6-5-11-29-22(17)32-19)13-10-20(23(37)38)33-24-30-14-18(15-31-24)25(26,27)28/h8-9,14-15,20H,3-7,10-13,16H2,1-2H3,(H,29,32)(H,37,38)(H,30,31,33)/t20-/m0/s1 |
| InChIKey | LGXRBPOHXLBIKM-FQEVSTJZSA-N |
| XLogP | 2.92 |
| TPSA | 123.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|