C30H40N6O3 — CID 139464444
(2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid (PubChem CID 139464444) has the molecular formula C30H40N6O3 and a molecular weight of 532.69 g/mol. Its IUPAC name is (2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464444 |
| Molecular Formula | C30H40N6O3 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.32 |
| IUPAC Name | (2S)-4-[[(2R)-2-methoxypropyl]-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-phenylpyrimidin-4-yl)amino]butanoic acid |
| SMILES | CO[C@H](C)CN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ccnc(-c2ccccc2)n1)C(=O)O |
| InChI | InChI=1S/C30H40N6O3/c1-22(39-2)21-36(19-7-6-12-25-14-13-24-11-8-17-31-28(24)33-25)20-16-26(30(37)38)34-27-15-18-32-29(35-27)23-9-4-3-5-10-23/h3-5,9-10,13-15,18,22,26H,6-8,11-12,16-17,19-21H2,1-2H3,(H,31,33)(H,37,38)(H,32,34,35)/t22-,26+/m1/s1 |
| InChIKey | IFLPSVYBZXWZIT-GJZUVCINSA-N |
| XLogP | 4.51 |
| TPSA | 112.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|