C32H37F2N7O2 — CID 139464483
(2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid (PubChem CID 139464483) has the molecular formula C32H37F2N7O2 and a molecular weight of 589.69 g/mol. Its IUPAC name is (2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid.
| Compound Name | (2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
|---|---|
| PubChem CID | 139464483 |
| Molecular Formula | C32H37F2N7O2 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.30 |
| IUPAC Name | (2S)-4-[3,3-difluoropropyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-[(2-pyridin-3-ylquinazolin-4-yl)amino]butanoic acid |
| SMILES | O=C(O)[C@H](CCN(CCCCc1ccc2c(n1)NCCC2)CCC(F)F)Nc1nc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C32H37F2N7O2/c33-28(34)15-20-41(18-4-3-9-24-13-12-22-7-6-17-36-29(22)37-24)19-14-27(32(42)43)39-31-25-10-1-2-11-26(25)38-30(40-31)23-8-5-16-35-21-23/h1-2,5,8,10-13,16,21,27-28H,3-4,6-7,9,14-15,17-20H2,(H,36,37)(H,42,43)(H,38,39,40)/t27-/m0/s1 |
| InChIKey | LNEXEMOTEQPVEF-MHZLTWQESA-N |
| XLogP | 5.68 |
| TPSA | 116.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|