C26H35N7O3 — CID 139464496
(2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid (PubChem CID 139464496) has the molecular formula C26H35N7O3 and a molecular weight of 493.61 g/mol. Its IUPAC name is (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid.
| Compound Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid |
|---|---|
| PubChem CID | 139464496 |
| Molecular Formula | C26H35N7O3 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.28 |
| IUPAC Name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(pyrido[2,3-d]pyrimidin-4-ylamino)butanoic acid |
| SMILES | COCCN(CCCCc1ccc2c(n1)NCCC2)CC[C@H](Nc1ncnc2ncccc12)C(=O)O |
| InChI | InChI=1S/C26H35N7O3/c1-36-17-16-33(14-3-2-7-20-10-9-19-6-4-12-27-23(19)31-20)15-11-22(26(34)35)32-25-21-8-5-13-28-24(21)29-18-30-25/h5,8-10,13,18,22H,2-4,6-7,11-12,14-17H2,1H3,(H,27,31)(H,34,35)(H,28,29,30,32)/t22-/m0/s1 |
| InChIKey | FXEXRGIVOAFXCR-QFIPXVFZSA-N |
| XLogP | 3.00 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|