C28H40N2O9 — CID 139465145
2-hydroxypropane-1,2,3-tricarboxylic acid;2-[6-[[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]-2-azaspiro[3.3]heptan-2-yl]propane-1,3-diol (PubChem CID 139465145) has the molecular formula C28H40N2O9 and a molecular weight of 548.63 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;2-[6-[[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]-2-azaspiro[3.3]heptan-2-yl]propane-1,3-diol.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2-[6-[[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]-2-azaspiro[3.3]heptan-2-yl]propane-1,3-diol |
|---|---|
| PubChem CID | 139465145 |
| Molecular Formula | C28H40N2O9 |
| Molecular Weight | 548.63 g/mol |
| Exact Mass | 548.27 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;2-[6-[[(1R,2S)-2-[(E)-1-phenylbut-1-en-2-yl]cyclopropyl]amino]-2-azaspiro[3.3]heptan-2-yl]propane-1,3-diol |
| SMILES | CC/C(=C\c1ccccc1)[C@@H]1C[C@H]1NC1CC2(C1)CN(C(CO)CO)C2.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H32N2O2.C6H8O7/c1-2-17(8-16-6-4-3-5-7-16)20-9-21(20)23-18-10-22(11-18)14-24(15-22)19(12-25)13-26;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-8,18-21,23,25-26H,2,9-15H2,1H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b17-8+;/t20-,21+;/m0./s1 |
| InChIKey | QVXLPQHYAWLRTH-LBZPHZISSA-N |
| XLogP | 1.03 |
| TPSA | 187.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |