C24H21F2N7O2 — CID 139465170
1-[(3R)-3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 139465170) has the molecular formula C24H21F2N7O2 and a molecular weight of 477.48 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139465170 |
| Molecular Formula | C24H21F2N7O2 |
| Molecular Weight | 477.48 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[6-(2,6-difluorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4c(F)cccc4F)nc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H21F2N7O2/c1-2-19(34)32-10-4-5-15(12-32)33-24-20(23(27)29-13-30-24)21(31-33)14-8-9-18(28-11-14)35-22-16(25)6-3-7-17(22)26/h2-3,6-9,11,13,15H,1,4-5,10,12H2,(H2,27,29,30)/t15-/m1/s1 |
| InChIKey | AHABTKYKORXURL-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|