C24H22ClN7O2 — CID 139465195
1-[(3R)-3-[4-amino-3-[6-(4-chlorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 139465195) has the molecular formula C24H22ClN7O2 and a molecular weight of 475.94 g/mol. Its IUPAC name is 1-[(3R)-3-[4-amino-3-[6-(4-chlorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[4-amino-3-[6-(4-chlorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139465195 |
| Molecular Formula | C24H22ClN7O2 |
| Molecular Weight | 475.94 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | 1-[(3R)-3-[4-amino-3-[6-(4-chlorophenoxy)-3-pyridinyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4ccc(Cl)cc4)nc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C24H22ClN7O2/c1-2-20(33)31-11-3-4-17(13-31)32-24-21(23(26)28-14-29-24)22(30-32)15-5-10-19(27-12-15)34-18-8-6-16(25)7-9-18/h2,5-10,12,14,17H,1,3-4,11,13H2,(H2,26,28,29)/t17-/m1/s1 |
| InChIKey | POERXYKRYQAMAK-QGZVFWFLSA-N |
| XLogP | 4.27 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.94 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|