C12H19N4O5S- — CID 139465682
CID 139465682 (PubChem CID 139465682) has the molecular formula C12H19N4O5S- and a molecular weight of 331.37 g/mol.
| Compound Name | CID 139465682 |
|---|---|
| PubChem CID | 139465682 |
| Molecular Formula | C12H19N4O5S- |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | — |
| SMILES | CN1CCOC(CNc2ccccc2[N+](=O)[O-])C1.NS(=O)[O-] |
| InChI | InChI=1S/C12H17N3O3.H3NO2S/c1-14-6-7-18-10(9-14)8-13-11-4-2-3-5-12(11)15(16)17;1-4(2)3/h2-5,10,13H,6-9H2,1H3;1H2,(H,2,3)/p-1 |
| InChIKey | FSXPBTURTPVRSC-UHFFFAOYSA-M |
| XLogP | 0.08 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|