C16H15F3N6O2 — CID 139465773
2-[3-[5-amino-6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol (PubChem CID 139465773) has the molecular formula C16H15F3N6O2 and a molecular weight of 380.33 g/mol. Its IUPAC name is 2-[3-[5-amino-6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol.
| Compound Name | 2-[3-[5-amino-6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol |
|---|---|
| PubChem CID | 139465773 |
| Molecular Formula | C16H15F3N6O2 |
| Molecular Weight | 380.33 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-[3-[5-amino-6-(1,2,4-triazol-1-yl)pyrazin-2-yl]-4-methylphenyl]-3,3,3-trifluoropropane-1,2-diol |
| SMILES | Cc1ccc(C(O)(CO)C(F)(F)F)cc1-c1cnc(N)c(-n2cncn2)n1 |
| InChI | InChI=1S/C16H15F3N6O2/c1-9-2-3-10(15(27,6-26)16(17,18)19)4-11(9)12-5-22-13(20)14(24-12)25-8-21-7-23-25/h2-5,7-8,26-27H,6H2,1H3,(H2,20,22) |
| InChIKey | YIXNUBVSQFYAOW-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.33 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |