C27H26N4O2 — CID 139465840
1-[(2S)-2-[1-[4-(2,3-dimethylphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 139465840) has the molecular formula C27H26N4O2 and a molecular weight of 438.53 g/mol. Its IUPAC name is 1-[(2S)-2-[1-[4-(2,3-dimethylphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(2S)-2-[1-[4-(2,3-dimethylphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 139465840 |
| Molecular Formula | C27H26N4O2 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.21 |
| IUPAC Name | 1-[(2S)-2-[1-[4-(2,3-dimethylphenoxy)phenyl]imidazo[1,5-a]pyrazin-3-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@H]1c1nc(-c2ccc(Oc3cccc(C)c3C)cc2)c2cnccn12 |
| InChI | InChI=1S/C27H26N4O2/c1-4-25(32)30-15-6-8-22(30)27-29-26(23-17-28-14-16-31(23)27)20-10-12-21(13-11-20)33-24-9-5-7-18(2)19(24)3/h4-5,7,9-14,16-17,22H,1,6,8,15H2,2-3H3/t22-/m0/s1 |
| InChIKey | ADMCZFZVXVCJOO-QFIPXVFZSA-N |
| XLogP | 5.65 |
| TPSA | 59.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|