C23H19F3N6O — CID 139465948
N-[4-(4,4-difluoropiperidin-1-yl)-6-fluoro-3-pyridinyl]-2-phenylimidazo[1,2-b]pyridazine-8-carboxamide (PubChem CID 139465948) has the molecular formula C23H19F3N6O and a molecular weight of 452.44 g/mol. Its IUPAC name is N-[4-(4,4-difluoropiperidin-1-yl)-6-fluoro-3-pyridinyl]-2-phenylimidazo[1,2-b]pyridazine-8-carboxamide.
| Compound Name | N-[4-(4,4-difluoropiperidin-1-yl)-6-fluoro-3-pyridinyl]-2-phenylimidazo[1,2-b]pyridazine-8-carboxamide |
|---|---|
| PubChem CID | 139465948 |
| Molecular Formula | C23H19F3N6O |
| Molecular Weight | 452.44 g/mol |
| Exact Mass | 452.16 |
| IUPAC Name | N-[4-(4,4-difluoropiperidin-1-yl)-6-fluoro-3-pyridinyl]-2-phenylimidazo[1,2-b]pyridazine-8-carboxamide |
| SMILES | O=C(Nc1cnc(F)cc1N1CCC(F)(F)CC1)c1ccnn2cc(-c3ccccc3)nc12 |
| InChI | InChI=1S/C23H19F3N6O/c24-20-12-19(31-10-7-23(25,26)8-11-31)17(13-27-20)30-22(33)16-6-9-28-32-14-18(29-21(16)32)15-4-2-1-3-5-15/h1-6,9,12-14H,7-8,10-11H2,(H,30,33) |
| InChIKey | CHZARGSIIZBMPM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 75.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|