About pyridine-3,5-dicarbonyl bromide
pyridine-3,5-dicarbonyl bromide (PubChem CID 139466513) has the molecular formula C7H3Br2NO2
and a molecular weight of 292.91 g/mol. Its IUPAC name is pyridine-3,5-dicarbonyl bromide.
Molecular Properties
| Compound Name | pyridine-3,5-dicarbonyl bromide |
| PubChem CID | 139466513 |
| Molecular Formula | C7H3Br2NO2 |
| Molecular Weight | 292.91 g/mol |
| Exact Mass | 290.85 |
| IUPAC Name | pyridine-3,5-dicarbonyl bromide |
| SMILES | O=C(Br)c1cncc(C(=O)Br)c1 |
| InChI | InChI=1S/C7H3Br2NO2/c8-6(11)4-1-5(7(9)12)3-10-2-4/h1-3H |
| InChIKey | YTOHRKQDEFKWDJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.91 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze pyridine-3,5-dicarbonyl bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyridine-3,5-dicarbonyl bromide?
The IUPAC name of pyridine-3,5-dicarbonyl bromide (CID 139466513) is pyridine-3,5-dicarbonyl bromide.
What is the SMILES notation for pyridine-3,5-dicarbonyl bromide?
The canonical SMILES for pyridine-3,5-dicarbonyl bromide is O=C(Br)c1cncc(C(=O)Br)c1.
What is the InChIKey of pyridine-3,5-dicarbonyl bromide?
The InChIKey is YTOHRKQDEFKWDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3Br2NO2/c8-6(11)4-1-5(7(9)12)3-10-2-4/h1-3H.
What are the key properties of pyridine-3,5-dicarbonyl bromide?
pyridine-3,5-dicarbonyl bromide has a molecular weight of 292.91 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyridine-3,5-dicarbonyl bromide is sourced from PubChem (CID 139466513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).