About [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone
[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone (PubChem CID 139466624) has the molecular formula C24H27N3O4
and a molecular weight of 421.50 g/mol. Its IUPAC name is [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone.
Molecular Properties
| Compound Name | [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone |
| PubChem CID | 139466624 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone |
| SMILES | CCOc1ccc(C(=O)N2CCC(c3ncnc4cc(OC)c(OC)cc34)CC2)cc1 |
| InChI | InChI=1S/C24H27N3O4/c1-4-31-18-7-5-17(6-8-18)24(28)27-11-9-16(10-12-27)23-19-13-21(29-2)22(30-3)14-20(19)25-15-26-23/h5-8,13-16H,4,9-12H2,1-3H3 |
| InChIKey | XEEPXUKKEWDPRT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone?
The IUPAC name of [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone (CID 139466624) is [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone.
What is the SMILES notation for [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone?
The canonical SMILES for [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone is CCOc1ccc(C(=O)N2CCC(c3ncnc4cc(OC)c(OC)cc34)CC2)cc1.
What is the InChIKey of [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone?
The InChIKey is XEEPXUKKEWDPRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O4/c1-4-31-18-7-5-17(6-8-18)24(28)27-11-9-16(10-12-27)23-19-13-21(29-2)22(30-3)14-20(19)25-15-26-23/h5-8,13-16H,4,9-12H2,1-3H3.
What are the key properties of [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone?
[4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone has a molecular weight of 421.50 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6,7-dimethoxyquinazolin-4-yl)piperidin-1-yl]-(4-ethoxyphenyl)methanone is sourced from PubChem (CID 139466624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).