C49H48N6O7 — CID 139466776
[(2R,6R)-6-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-propan-2-ylmorpholin-2-yl]methyl benzoate (PubChem CID 139466776) has the molecular formula C49H48N6O7 and a molecular weight of 832.96 g/mol. Its IUPAC name is [(2R,6R)-6-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-propan-2-ylmorpholin-2-yl]methyl benzoate.
| Compound Name | [(2R,6R)-6-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-propan-2-ylmorpholin-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 139466776 |
| Molecular Formula | C49H48N6O7 |
| Molecular Weight | 832.96 g/mol |
| Exact Mass | 832.36 |
| IUPAC Name | [(2R,6R)-6-(6-benzamidopurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-propan-2-ylmorpholin-2-yl]methyl benzoate |
| SMILES | COc1ccc(C(OC[C@@]2(COC(=O)c3ccccc3)CN(C(C)C)C[C@H](n3cnc4c(NC(=O)c5ccccc5)ncnc43)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C49H48N6O7/c1-34(2)54-28-42(55-33-52-43-44(50-32-51-45(43)55)53-46(56)35-14-8-5-9-15-35)62-48(29-54,30-60-47(57)36-16-10-6-11-17-36)31-61-49(37-18-12-7-13-19-37,38-20-24-40(58-3)25-21-38)39-22-26-41(59-4)27-23-39/h5-27,32-34,42H,28-31H2,1-4H3,(H,50,51,53,56)/t42-,48+/m1/s1 |
| InChIKey | UTINDUVCVGIFFB-LUCIEEKYSA-N |
| XLogP | 7.94 |
| TPSA | 139.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.96 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|