C23H28FN5O4 — CID 139466873
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl undec-9-ynoate (PubChem CID 139466873) has the molecular formula C23H28FN5O4 and a molecular weight of 457.51 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl undec-9-ynoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl undec-9-ynoate |
|---|---|
| PubChem CID | 139466873 |
| Molecular Formula | C23H28FN5O4 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.21 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl undec-9-ynoate |
| SMILES | C#C[C@]1(COC(=O)CCCCCCCC#CC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C23H28FN5O4/c1-3-5-6-7-8-9-10-11-12-18(31)32-14-23(4-2)16(30)13-17(33-23)29-15-26-19-20(25)27-22(24)28-21(19)29/h2,15-17,30H,6-14H2,1H3,(H2,25,27,28)/t16-,17+,23+/m0/s1 |
| InChIKey | VTHHISAJDLCBQU-YGKZAACZSA-N |
| XLogP | 2.50 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|