C12H22S — CID 139467315
(4S)-4-methyl-2-methylidene-1-(2-methylsulfanylpropan-2-yl)cyclohexane (PubChem CID 139467315) has the molecular formula C12H22S and a molecular weight of 198.37 g/mol. Its IUPAC name is (4S)-4-methyl-2-methylidene-1-(2-methylsulfanylpropan-2-yl)cyclohexane.
| Compound Name | (4S)-4-methyl-2-methylidene-1-(2-methylsulfanylpropan-2-yl)cyclohexane |
|---|---|
| PubChem CID | 139467315 |
| Molecular Formula | C12H22S |
| Molecular Weight | 198.37 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | (4S)-4-methyl-2-methylidene-1-(2-methylsulfanylpropan-2-yl)cyclohexane |
| SMILES | C=C1C[C@@H](C)CCC1C(C)(C)SC |
| InChI | InChI=1S/C12H22S/c1-9-6-7-11(10(2)8-9)12(3,4)13-5/h9,11H,2,6-8H2,1,3-5H3/t9-,11?/m0/s1 |
| InChIKey | RFUFKVMGROMYIE-FTNKSUMCSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|