About 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide
3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide (PubChem CID 139467450) has the molecular formula C14H16N2O3
and a molecular weight of 260.29 g/mol. Its IUPAC name is 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 139467450 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1onc(Cc2ccccc2)c1C |
| InChI | InChI=1S/C14H16N2O3/c1-10-12(9-11-7-5-4-6-8-11)15-19-13(10)14(17)16(2)18-3/h4-8H,9H2,1-3H3 |
| InChIKey | QIPAPZLTUIHWBG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide (CID 139467450) is 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide is CON(C)C(=O)c1onc(Cc2ccccc2)c1C.
What is the InChIKey of 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide?
The InChIKey is QIPAPZLTUIHWBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O3/c1-10-12(9-11-7-5-4-6-8-11)15-19-13(10)14(17)16(2)18-3/h4-8H,9H2,1-3H3.
What are the key properties of 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide?
3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide has a molecular weight of 260.29 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-N-methoxy-N,4-dimethyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 139467450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).