C11H12BrFN2O3 — CID 139467608
2-[(5-bromo-2-fluorobenzoyl)amino]ethyl N-methylcarbamate (PubChem CID 139467608) has the molecular formula C11H12BrFN2O3 and a molecular weight of 319.13 g/mol. Its IUPAC name is 2-[(5-bromo-2-fluorobenzoyl)amino]ethyl N-methylcarbamate.
| Compound Name | 2-[(5-bromo-2-fluorobenzoyl)amino]ethyl N-methylcarbamate |
|---|---|
| PubChem CID | 139467608 |
| Molecular Formula | C11H12BrFN2O3 |
| Molecular Weight | 319.13 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | 2-[(5-bromo-2-fluorobenzoyl)amino]ethyl N-methylcarbamate |
| SMILES | CNC(=O)OCCNC(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H12BrFN2O3/c1-14-11(17)18-5-4-15-10(16)8-6-7(12)2-3-9(8)13/h2-3,6H,4-5H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | NEWHGSSXWXGZQN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.13 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|