C21H28FN5O4 — CID 139468155
[(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl nonanoate (PubChem CID 139468155) has the molecular formula C21H28FN5O4 and a molecular weight of 433.48 g/mol. Its IUPAC name is [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl nonanoate.
| Compound Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl nonanoate |
|---|---|
| PubChem CID | 139468155 |
| Molecular Formula | C21H28FN5O4 |
| Molecular Weight | 433.48 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | [(2R,3S,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-ethynyl-3-hydroxyoxolan-2-yl]methyl nonanoate |
| SMILES | C#C[C@]1(COC(=O)CCCCCCCC)O[C@@H](n2cnc3c(N)nc(F)nc32)C[C@@H]1O |
| InChI | InChI=1S/C21H28FN5O4/c1-3-5-6-7-8-9-10-16(29)30-12-21(4-2)14(28)11-15(31-21)27-13-24-17-18(23)25-20(22)26-19(17)27/h2,13-15,28H,3,5-12H2,1H3,(H2,23,25,26)/t14-,15+,21+/m0/s1 |
| InChIKey | TYUIGLJTLCIKMU-PDSXEYIOSA-N |
| XLogP | 2.49 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.48 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|