C15H13NO7 — CID 139468635
4-O-[2-[(7aS)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl] 1-O-methyl (E)-but-2-enedioate (PubChem CID 139468635) has the molecular formula C15H13NO7 and a molecular weight of 319.27 g/mol. Its IUPAC name is 4-O-[2-[(7aS)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl] 1-O-methyl (E)-but-2-enedioate.
| Compound Name | 4-O-[2-[(7aS)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl] 1-O-methyl (E)-but-2-enedioate |
|---|---|
| PubChem CID | 139468635 |
| Molecular Formula | C15H13NO7 |
| Molecular Weight | 319.27 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-O-[2-[(7aS)-1,3-dioxo-3a,7a-dihydro-4,7-epoxyisoindol-2-yl]ethyl] 1-O-methyl (E)-but-2-enedioate |
| SMILES | COC(=O)/C=C/C(=O)OCCN1C(=O)C2c3ccc(o3)[C@H]2C1=O |
| InChI | InChI=1S/C15H13NO7/c1-21-10(17)4-5-11(18)22-7-6-16-14(19)12-8-2-3-9(23-8)13(12)15(16)20/h2-5,12-13H,6-7H2,1H3/b5-4+/t12-,13?/m1/s1 |
| InChIKey | VEIIOABATWCJDT-MONITJSVSA-N |
| XLogP | 0.10 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|