C22H35N — CID 139468997
(3Z,5E,8Z)-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-3,5,8-trien-2-amine (PubChem CID 139468997) has the molecular formula C22H35N and a molecular weight of 313.53 g/mol. Its IUPAC name is (3Z,5E,8Z)-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-3,5,8-trien-2-amine.
| Compound Name | (3Z,5E,8Z)-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-3,5,8-trien-2-amine |
|---|---|
| PubChem CID | 139468997 |
| Molecular Formula | C22H35N |
| Molecular Weight | 313.53 g/mol |
| Exact Mass | 313.28 |
| IUPAC Name | (3Z,5E,8Z)-6,8-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]-N-prop-1-en-2-ylundeca-3,5,8-trien-2-amine |
| SMILES | C=C(C)NC(C)/C=C(/C=C(\C)C/C(C)=C\CC)C(=C/C)\C(=C)C |
| InChI | InChI=1S/C22H35N/c1-10-12-18(7)13-19(8)14-21(22(11-2)16(3)4)15-20(9)23-17(5)6/h11-12,14-15,20,23H,3,5,10,13H2,1-2,4,6-9H3/b18-12-,19-14+,21-15-,22-11- |
| InChIKey | WZARKACPZHKKCD-QCOJAPHWSA-N |
| XLogP | 6.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.53 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|