C19H17N5O2 — CID 139469052
cis-(1R,2R)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide (PubChem CID 139469052) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is cis-(1R,2R)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2R)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 139469052 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | cis-(1R,2R)-N-[8-amino-6-(4-methyl-3-pyridinyl)-2,7-naphthyridin-3-yl]-2-formylcyclopropane-1-carboxamide |
| SMILES | Cc1ccncc1-c1cc2cc(NC(=O)[C@@H]3C[C@H]3C=O)ncc2c(N)n1 |
| InChI | InChI=1S/C19H17N5O2/c1-10-2-3-21-7-14(10)16-5-11-6-17(22-8-15(11)18(20)23-16)24-19(26)13-4-12(13)9-25/h2-3,5-9,12-13H,4H2,1H3,(H2,20,23)(H,22,24,26)/t12-,13+/m0/s1 |
| InChIKey | FYEINDOUGUIOPU-QWHCGFSZSA-N |
| XLogP | 2.36 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|