C23H35N — CID 139469089
(3Z,5E)-N-[(2,3-dimethylcyclopropyl)methyl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine (PubChem CID 139469089) has the molecular formula C23H35N and a molecular weight of 325.54 g/mol. Its IUPAC name is (3Z,5E)-N-[(2,3-dimethylcyclopropyl)methyl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine.
| Compound Name | (3Z,5E)-N-[(2,3-dimethylcyclopropyl)methyl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine |
|---|---|
| PubChem CID | 139469089 |
| Molecular Formula | C23H35N |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.28 |
| IUPAC Name | (3Z,5E)-N-[(2,3-dimethylcyclopropyl)methyl]-N,6-dimethyl-4-[(3Z)-2-methylpenta-1,3-dien-3-yl]nona-1,3,5,8-tetraen-2-amine |
| SMILES | C=CC/C(C)=C/C(=CC(=C)N(C)CC1C(C)C1C)/C(=C\C)C(=C)C |
| InChI | InChI=1S/C23H35N/c1-10-12-17(5)13-21(22(11-2)16(3)4)14-18(6)24(9)15-23-19(7)20(23)8/h10-11,13-14,19-20,23H,1,3,6,12,15H2,2,4-5,7-9H3/b17-13+,21-14-,22-11- |
| InChIKey | XHHXXRVXTGQLTI-IHISCJNESA-N |
| XLogP | 6.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|