C21H21N5O — CID 139469189
(2R,3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hexa-3,5-dien-2-ol (PubChem CID 139469189) has the molecular formula C21H21N5O and a molecular weight of 359.43 g/mol. Its IUPAC name is (2R,3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hexa-3,5-dien-2-ol.
| Compound Name | (2R,3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hexa-3,5-dien-2-ol |
|---|---|
| PubChem CID | 139469189 |
| Molecular Formula | C21H21N5O |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2R,3E)-3-ethenyl-1-(5-phenyl-2-pyridinyl)-2-(tetrazol-1-ylmethyl)hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C=C)[C@](O)(Cc1ccc(-c2ccccc2)cn1)Cn1cnnn1 |
| InChI | InChI=1S/C21H21N5O/c1-3-8-19(4-2)21(27,15-26-16-23-24-25-26)13-20-12-11-18(14-22-20)17-9-6-5-7-10-17/h3-12,14,16,27H,1-2,13,15H2/b19-8+/t21-/m0/s1 |
| InChIKey | GWXSOKTXVUTGBY-ILFJLPAMSA-N |
| XLogP | 3.01 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|