C22H28F2N3O6+ — CID 139469906
(E)-4-[[(3S,3aR,6S,6aR)-6-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,2-difluorobut-3-enoic acid (PubChem CID 139469906) has the molecular formula C22H28F2N3O6+ and a molecular weight of 468.48 g/mol. Its IUPAC name is (E)-4-[[(3S,3aR,6S,6aR)-6-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,2-difluorobut-3-enoic acid.
| Compound Name | (E)-4-[[(3S,3aR,6S,6aR)-6-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,2-difluorobut-3-enoic acid |
|---|---|
| PubChem CID | 139469906 |
| Molecular Formula | C22H28F2N3O6+ |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (E)-4-[[(3S,3aR,6S,6aR)-6-[2-(aminomethyl)-1,3-diethylbenzimidazol-1-ium-5-yl]oxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,2-difluorobut-3-enoic acid |
| SMILES | CCn1c(CN)[n+](CC)c2ccc(O[C@H]3CO[C@H]4[C@@H]3OC[C@@H]4O/C=C/C(F)(F)C(=O)O)cc21 |
| InChI | InChI=1S/C22H27F2N3O6/c1-3-26-14-6-5-13(9-15(14)27(4-2)18(26)10-25)33-17-12-32-19-16(11-31-20(17)19)30-8-7-22(23,24)21(28)29/h5-9,16-17,19-20H,3-4,10-12,25H2,1-2H3/p+1/b8-7+/t16-,17-,19+,20+/m0/s1 |
| InChIKey | BPMJBWOIWCTBAX-DFNOIFQUSA-O |
| XLogP | 1.59 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|