C21H31NO2 — CID 139469922
N-[[4-(4,6-dimethyl-5-oxohept-6-enyl)cyclohexa-1,3-dien-1-yl]methyl]-N,2-dimethylprop-2-enamide (PubChem CID 139469922) has the molecular formula C21H31NO2 and a molecular weight of 329.48 g/mol. Its IUPAC name is N-[[4-(4,6-dimethyl-5-oxohept-6-enyl)cyclohexa-1,3-dien-1-yl]methyl]-N,2-dimethylprop-2-enamide.
| Compound Name | N-[[4-(4,6-dimethyl-5-oxohept-6-enyl)cyclohexa-1,3-dien-1-yl]methyl]-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 139469922 |
| Molecular Formula | C21H31NO2 |
| Molecular Weight | 329.48 g/mol |
| Exact Mass | 329.24 |
| IUPAC Name | N-[[4-(4,6-dimethyl-5-oxohept-6-enyl)cyclohexa-1,3-dien-1-yl]methyl]-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)C(C)CCCC1=CC=C(CN(C)C(=O)C(=C)C)CC1 |
| InChI | InChI=1S/C21H31NO2/c1-15(2)20(23)17(5)8-7-9-18-10-12-19(13-11-18)14-22(6)21(24)16(3)4/h10,12,17H,1,3,7-9,11,13-14H2,2,4-6H3 |
| InChIKey | ZRXZYBVTPDWBMB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|