C20H31N3 — CID 139469997
(E)-N'-ethenyl-2-methyl-3-(methylamino)-N-[(3E,5E)-2,5,6,7-tetramethylocta-1,3,5,7-tetraen-3-yl]but-2-enimidamide (PubChem CID 139469997) has the molecular formula C20H31N3 and a molecular weight of 313.49 g/mol. Its IUPAC name is (E)-N'-ethenyl-2-methyl-3-(methylamino)-N-[(3E,5E)-2,5,6,7-tetramethylocta-1,3,5,7-tetraen-3-yl]but-2-enimidamide.
| Compound Name | (E)-N'-ethenyl-2-methyl-3-(methylamino)-N-[(3E,5E)-2,5,6,7-tetramethylocta-1,3,5,7-tetraen-3-yl]but-2-enimidamide |
|---|---|
| PubChem CID | 139469997 |
| Molecular Formula | C20H31N3 |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | (E)-N'-ethenyl-2-methyl-3-(methylamino)-N-[(3E,5E)-2,5,6,7-tetramethylocta-1,3,5,7-tetraen-3-yl]but-2-enimidamide |
| SMILES | C=C/N=C(N/C(=C/C(C)=C(\C)C(=C)C)C(=C)C)\C(C)=C(/C)NC |
| InChI | InChI=1S/C20H31N3/c1-11-22-20(17(8)18(9)21-10)23-19(14(4)5)12-15(6)16(7)13(2)3/h11-12,21H,1-2,4H2,3,5-10H3,(H,22,23)/b16-15+,18-17+,19-12+ |
| InChIKey | KJWVIWHDNOHZHA-TXPPJKEJSA-N |
| XLogP | 5.00 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|