C26H39N2PS — CID 139470172
[(7Z,8E)-7-[(Z)-but-2-enylidene]-2-butylsulfanyl-4-(2-cyclopentylethyl)-8-ethylidene-5-methyl-6H-quinazolin-5-yl]phosphane (PubChem CID 139470172) has the molecular formula C26H39N2PS and a molecular weight of 442.65 g/mol. Its IUPAC name is [(7Z,8E)-7-[(Z)-but-2-enylidene]-2-butylsulfanyl-4-(2-cyclopentylethyl)-8-ethylidene-5-methyl-6H-quinazolin-5-yl]phosphane.
| Compound Name | [(7Z,8E)-7-[(Z)-but-2-enylidene]-2-butylsulfanyl-4-(2-cyclopentylethyl)-8-ethylidene-5-methyl-6H-quinazolin-5-yl]phosphane |
|---|---|
| PubChem CID | 139470172 |
| Molecular Formula | C26H39N2PS |
| Molecular Weight | 442.65 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | [(7Z,8E)-7-[(Z)-but-2-enylidene]-2-butylsulfanyl-4-(2-cyclopentylethyl)-8-ethylidene-5-methyl-6H-quinazolin-5-yl]phosphane |
| SMILES | C/C=C\C=C1\CC(C)(P)c2c(CCC3CCCC3)nc(SCCCC)nc2\C1=C\C |
| InChI | InChI=1S/C26H39N2PS/c1-5-8-14-20-18-26(4,29)23-22(16-15-19-12-10-11-13-19)27-25(30-17-9-6-2)28-24(23)21(20)7-3/h5,7-8,14,19H,6,9-13,15-18,29H2,1-4H3/b8-5-,20-14-,21-7+ |
| InChIKey | ZHBIUZYNSZZKDH-OURMBKLTSA-N |
| XLogP | 7.89 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.65 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|