C33H43N — CID 139470391
N-cyclohexa-2,4-dien-1-ylpentacyclo[20.5.0.02,7.09,14.015,20]heptacosa-1(22),2(7),9(14),12,18-pentaen-18-amine (PubChem CID 139470391) has the molecular formula C33H43N and a molecular weight of 453.71 g/mol. Its IUPAC name is N-cyclohexa-2,4-dien-1-ylpentacyclo[20.5.0.02,7.09,14.015,20]heptacosa-1(22),2(7),9(14),12,18-pentaen-18-amine.
| Compound Name | N-cyclohexa-2,4-dien-1-ylpentacyclo[20.5.0.02,7.09,14.015,20]heptacosa-1(22),2(7),9(14),12,18-pentaen-18-amine |
|---|---|
| PubChem CID | 139470391 |
| Molecular Formula | C33H43N |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | N-cyclohexa-2,4-dien-1-ylpentacyclo[20.5.0.02,7.09,14.015,20]heptacosa-1(22),2(7),9(14),12,18-pentaen-18-amine |
| SMILES | C1=CCC(NC2=CC3CC4=C(CCCCC4)C4=C(CCCC4)CC4=C(C=CCC4)C3CC2)C=C1 |
| InChI | InChI=1S/C33H43N/c1-3-11-26-22-27-23-29(34-28-14-4-2-5-15-28)19-20-33(27)32-18-10-8-13-25(32)21-24-12-7-9-17-31(24)30(26)16-6-1/h2,4-5,10,14,18,23,27-28,33-34H,1,3,6-9,11-13,15-17,19-22H2 |
| InChIKey | YINNZGPJAIUGEH-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |