C16H29NO — CID 139470817
3,3,5,5-tetramethyl-1-[(2Z,4Z)-4-methylhexa-2,4-dienyl]piperidin-4-ol (PubChem CID 139470817) has the molecular formula C16H29NO and a molecular weight of 251.41 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-1-[(2Z,4Z)-4-methylhexa-2,4-dienyl]piperidin-4-ol.
| Compound Name | 3,3,5,5-tetramethyl-1-[(2Z,4Z)-4-methylhexa-2,4-dienyl]piperidin-4-ol |
|---|---|
| PubChem CID | 139470817 |
| Molecular Formula | C16H29NO |
| Molecular Weight | 251.41 g/mol |
| Exact Mass | 251.22 |
| IUPAC Name | 3,3,5,5-tetramethyl-1-[(2Z,4Z)-4-methylhexa-2,4-dienyl]piperidin-4-ol |
| SMILES | C/C=C(C)\C=C/CN1CC(C)(C)C(O)C(C)(C)C1 |
| InChI | InChI=1S/C16H29NO/c1-7-13(2)9-8-10-17-11-15(3,4)14(18)16(5,6)12-17/h7-9,14,18H,10-12H2,1-6H3/b9-8-,13-7- |
| InChIKey | ZQKRZSRWCVKIOA-XOKMEUMPSA-N |
| XLogP | 3.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.41 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|