C17H27NO — CID 139470827
1-(4-ethylphenyl)-3,3,5,5-tetramethylpiperidin-4-ol (PubChem CID 139470827) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-3,3,5,5-tetramethylpiperidin-4-ol.
| Compound Name | 1-(4-ethylphenyl)-3,3,5,5-tetramethylpiperidin-4-ol |
|---|---|
| PubChem CID | 139470827 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 1-(4-ethylphenyl)-3,3,5,5-tetramethylpiperidin-4-ol |
| SMILES | CCc1ccc(N2CC(C)(C)C(O)C(C)(C)C2)cc1 |
| InChI | InChI=1S/C17H27NO/c1-6-13-7-9-14(10-8-13)18-11-16(2,3)15(19)17(4,5)12-18/h7-10,15,19H,6,11-12H2,1-5H3 |
| InChIKey | SZGYMEXYBMMPPD-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|