C31H31N3O2 — CID 139470927
4-[3-[(1E,3E,5Z)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]cycloocta-1,3,5-trien-1-yl]-4-methoxyquinolin-8-yl]benzonitrile (PubChem CID 139470927) has the molecular formula C31H31N3O2 and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-[3-[(1E,3E,5Z)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]cycloocta-1,3,5-trien-1-yl]-4-methoxyquinolin-8-yl]benzonitrile.
| Compound Name | 4-[3-[(1E,3E,5Z)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]cycloocta-1,3,5-trien-1-yl]-4-methoxyquinolin-8-yl]benzonitrile |
|---|---|
| PubChem CID | 139470927 |
| Molecular Formula | C31H31N3O2 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.24 |
| IUPAC Name | 4-[3-[(1E,3E,5Z)-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]cycloocta-1,3,5-trien-1-yl]-4-methoxyquinolin-8-yl]benzonitrile |
| SMILES | COc1c(/C2=C/C=C(N3C[C@@H](C)O[C@@H](C)C3)\C=C/CC2)cnc2c(-c3ccc(C#N)cc3)cccc12 |
| InChI | InChI=1S/C31H31N3O2/c1-21-19-34(20-22(2)36-21)26-8-5-4-7-24(15-16-26)29-18-33-30-27(9-6-10-28(30)31(29)35-3)25-13-11-23(17-32)12-14-25/h5-6,8-16,18,21-22H,4,7,19-20H2,1-3H3/b8-5-,24-15+,26-16+/t21-,22+ |
| InChIKey | MVWDAHIMLIKEJO-FLOLVQEHSA-N |
| XLogP | 6.51 |
| TPSA | 58.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |