About 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline
5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline (PubChem CID 139470942) has the molecular formula C12H14FNO
and a molecular weight of 207.25 g/mol. Its IUPAC name is 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline.
Molecular Properties
| Compound Name | 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline |
| PubChem CID | 139470942 |
| Molecular Formula | C12H14FNO |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline |
| SMILES | COc1c(C)cnc2c1C(F)=CCC2C |
| InChI | InChI=1S/C12H14FNO/c1-7-4-5-9(13)10-11(7)14-6-8(2)12(10)15-3/h5-7H,4H2,1-3H3 |
| InChIKey | QEDFZULIRXYIIN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline?
The IUPAC name of 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline (CID 139470942) is 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline.
What is the SMILES notation for 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline?
The canonical SMILES for 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline is COc1c(C)cnc2c1C(F)=CCC2C.
What is the InChIKey of 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline?
The InChIKey is QEDFZULIRXYIIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14FNO/c1-7-4-5-9(13)10-11(7)14-6-8(2)12(10)15-3/h5-7H,4H2,1-3H3.
What are the key properties of 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline?
5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline has a molecular weight of 207.25 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-4-methoxy-3,8-dimethyl-7,8-dihydroquinoline is sourced from PubChem (CID 139470942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).