C17H29F3N2 — CID 139471121
(6E)-6-[(Z)-but-2-en-2-yl]-3-N,7-dimethyl-2-N-(2,2,2-trifluoroethyl)nona-6,8-diene-2,3-diamine (PubChem CID 139471121) has the molecular formula C17H29F3N2 and a molecular weight of 318.43 g/mol. Its IUPAC name is (6E)-6-[(Z)-but-2-en-2-yl]-3-N,7-dimethyl-2-N-(2,2,2-trifluoroethyl)nona-6,8-diene-2,3-diamine.
| Compound Name | (6E)-6-[(Z)-but-2-en-2-yl]-3-N,7-dimethyl-2-N-(2,2,2-trifluoroethyl)nona-6,8-diene-2,3-diamine |
|---|---|
| PubChem CID | 139471121 |
| Molecular Formula | C17H29F3N2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | (6E)-6-[(Z)-but-2-en-2-yl]-3-N,7-dimethyl-2-N-(2,2,2-trifluoroethyl)nona-6,8-diene-2,3-diamine |
| SMILES | C=C/C(C)=C(CCC(NC)C(C)NCC(F)(F)F)/C(C)=C\C |
| InChI | InChI=1S/C17H29F3N2/c1-7-12(3)15(13(4)8-2)9-10-16(21-6)14(5)22-11-17(18,19)20/h7-8,14,16,21-22H,1,9-11H2,2-6H3/b13-8-,15-12+ |
| InChIKey | CJMFYEMPCPASKG-RRKOQZBASA-N |
| XLogP | 4.36 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|